1556-18-9 Iodocyclopentane
| ürün Ad? |
Iodocyclopentane |
| ingilizce ad? |
Iodocyclopentane; Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
| Moleküler Formülü |
C8H7NOS |
| Molekül A??rl??? |
165.2123 |
| InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| CAS kay?t numaras? |
1556-18-9 |
| EINECS |
216-311-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.08g/cm3 |
| Kaynama noktas? |
280.5°C at 760 mmHg |
| K?r?lma indisi |
1.551 |
| Alevlenme noktas? |
123.4°C |
| Buhar bas?nc? |
0.00642mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|