1556-18-9 Iodocyclopentane
| product Name |
Iodocyclopentane |
| CAS No |
1556-18-9 |
| Synonyms |
Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
| Molecular Formula |
C8H7NOS |
| Molecular Weight |
165.2123 |
| InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| EINECS |
216-311-1 |
| Molecular Structure |
|
| Density |
1.08g/cm3 |
| Boiling point |
280.5°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
123.4°C |
| Vapour Pressur |
0.00642mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |