1556-18-9 Iodocyclopentane
| ??? ????? |
Iodocyclopentane |
| ??? ??????? |
Iodocyclopentane; Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
| ????? ???????? |
C8H7NOS |
| ??? ??????? |
165.2123 |
| InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| ????? ?????? |
1556-18-9 |
| ????? ??????? ??????? |
216-311-1 |
| ?????? ??????? |
|
| ????? |
1.08g/cm3 |
| ???? ????? |
280.5°C at 760 mmHg |
| ???? ???? |
1.551 |
| ???? ?????? |
123.4°C |
| ???? ???? |
0.00642mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|