1556-18-9 Iodocyclopentane
| Naam product |
Iodocyclopentane |
| Engelse naam |
Iodocyclopentane; Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
| MF |
C8H7NOS |
| Molecuulgewicht |
165.2123 |
| InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| CAS-nummer |
1556-18-9 |
| EINECS |
216-311-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.08g/cm3 |
| Kookpunt |
280.5°C at 760 mmHg |
| Brekingsindex |
1.551 |
| Vlampunt |
123.4°C |
| Dampdruk |
0.00642mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|