1467-79-4 Dimethylcyanamide
| ??? ?????? |
Dimethylcyanamide |
| ????? ??????????? |
Dimethylcyanamide;Dimethyl cyanamide; AI3-22164; CCRIS 5909; Cyanamide, dimethyl-; Dimethylkyanamid; Dimethylkyanamid [Czech]; HSDB 4274; N-Cyano-N-methylmethanamine; N-Cyanodimethylamine; NSC 7765; Cyanamide, N,N-dimethyl- |
| ?????? ???????? |
C3H6N2 |
| ????? ??????? ??????? |
70.0931 |
| InChI |
InChI=1/C3H6N2/c1-5(2)3-4/h1-2H3 |
| ?????????? ???????? ??????? |
1467-79-4 |
| ???????? ????????? ??? |
215-991-7 |
| ???? ?????? |
|
| ????? |
0.89g/cm3 |
| ???? ???????? |
-41℃ |
| ???? ??????? |
163.5°C at 760 mmHg |
| ????? ???????? |
1.412 |
| ???? ?????? |
58.3°C |
| ??? ?????? |
2.06mmHg at 25°C |
| ?????? ??? ??????? ?????? |
T:Toxic;
|
| ??? ????????? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|