1467-79-4 Dimethylcyanamide
| Название продукта |
Dimethylcyanamide |
| Английское название |
Dimethylcyanamide;Dimethyl cyanamide; AI3-22164; CCRIS 5909; Cyanamide, dimethyl-; Dimethylkyanamid; Dimethylkyanamid [Czech]; HSDB 4274; N-Cyano-N-methylmethanamine; N-Cyanodimethylamine; NSC 7765; Cyanamide, N,N-dimethyl- |
| Молекулярная формула |
C3H6N2 |
| Молекулярный вес |
70.0931 |
| InChI |
InChI=1/C3H6N2/c1-5(2)3-4/h1-2H3 |
| Регистрационный номер CAS |
1467-79-4 |
| EINECS |
215-991-7 |
| Молекулярная структура |
|
| Плотность |
0.89g/cm3 |
| Температура плавления |
-41℃ |
| Точка кипения |
163.5°C at 760 mmHg |
| Показатель преломления |
1.412 |
| Температура вспышки |
58.3°C |
| Давление пара |
2.06mmHg at 25°C |
| Символы опасности |
T:Toxic;
|
| Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|