1467-79-4 Dimethylcyanamide
| Nome del prodotto |
Dimethylcyanamide |
| Nome inglese |
Dimethylcyanamide;Dimethyl cyanamide; AI3-22164; CCRIS 5909; Cyanamide, dimethyl-; Dimethylkyanamid; Dimethylkyanamid [Czech]; HSDB 4274; N-Cyano-N-methylmethanamine; N-Cyanodimethylamine; NSC 7765; Cyanamide, N,N-dimethyl- |
| Formula molecolare |
C3H6N2 |
| Peso Molecolare |
70.0931 |
| InChI |
InChI=1/C3H6N2/c1-5(2)3-4/h1-2H3 |
| Numero CAS |
1467-79-4 |
| EINECS |
215-991-7 |
| Struttura molecolare |
|
| Densità |
0.89g/cm3 |
| Punto di fusione |
-41℃ |
| Punto di ebollizione |
163.5°C at 760 mmHg |
| Indice di rifrazione |
1.412 |
| Punto d'infiammabilità |
58.3°C |
| Pressione di vapore |
2.06mmHg at 25°C |
| Simboli di pericolo |
T:Toxic;
|
| Codici di Rischio |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|