1467-79-4 Dimethylcyanamide
| Produkt-Name |
Dimethylcyanamide |
| Englischer Name |
Dimethylcyanamide;Dimethyl cyanamide; AI3-22164; CCRIS 5909; Cyanamide, dimethyl-; Dimethylkyanamid; Dimethylkyanamid [Czech]; HSDB 4274; N-Cyano-N-methylmethanamine; N-Cyanodimethylamine; NSC 7765; Cyanamide, N,N-dimethyl- |
| Molekulare Formel |
C3H6N2 |
| Molecular Weight |
70.0931 |
| InChI |
InChI=1/C3H6N2/c1-5(2)3-4/h1-2H3 |
| CAS Registry Number |
1467-79-4 |
| EINECS |
215-991-7 |
| Molecular Structure |
|
| Dichte |
0.89g/cm3 |
| Schmelzpunkt |
-41℃ |
| Siedepunkt |
163.5°C at 760 mmHg |
| Brechungsindex |
1.412 |
| Flammpunkt |
58.3°C |
| Dampfdruck |
2.06mmHg at 25°C |
| Gefahrensymbole |
T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|