ChemNet > CAS > 4771-49-7 6-Methylindole-3-caboxaldehyde
4771-49-7 6-Methylindole-3-caboxaldehyde
| Название продукта |
6-Methylindole-3-caboxaldehyde |
| Английское название |
6-Methylindole-3-caboxaldehyde; 6-Methylindole-3-carboxaldehyde; 3-Formyl-6-methylindole; 6-methyl-1H-indole-3-carbaldehyde |
| Молекулярная формула |
C10H9NO |
| Молекулярный вес |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-2-3-9-8(6-12)5-11-10(9)4-7/h2-6,11H,1H3 |
| Регистрационный номер CAS |
4771-49-7 |
| Молекулярная структура |
|
| Плотность |
1.226g/cm3 |
| Точка кипения |
339.3°C at 760 mmHg |
| Показатель преломления |
1.698 |
| Температура вспышки |
167°C |
| Давление пара |
9.27E-05mmHg at 25°C |
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|