ChemNet > CAS > 4771-49-7 6-Methylindole-3-caboxaldehyde
4771-49-7 6-Methylindole-3-caboxaldehyde
| Naam product |
6-Methylindole-3-caboxaldehyde |
| Engelse naam |
6-Methylindole-3-caboxaldehyde; 6-Methylindole-3-carboxaldehyde; 3-Formyl-6-methylindole; 6-methyl-1H-indole-3-carbaldehyde |
| MF |
C10H9NO |
| Molecuulgewicht |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-2-3-9-8(6-12)5-11-10(9)4-7/h2-6,11H,1H3 |
| CAS-nummer |
4771-49-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.226g/cm3 |
| Kookpunt |
339.3°C at 760 mmHg |
| Brekingsindex |
1.698 |
| Vlampunt |
167°C |
| Dampdruk |
9.27E-05mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|