ChemNet > CAS > 4771-49-7 6-Methylindole-3-caboxaldehyde
4771-49-7 6-Methylindole-3-caboxaldehyde
| Nome del prodotto |
6-Methylindole-3-caboxaldehyde |
| Nome inglese |
6-Methylindole-3-caboxaldehyde; 6-Methylindole-3-carboxaldehyde; 3-Formyl-6-methylindole; 6-methyl-1H-indole-3-carbaldehyde |
| Formula molecolare |
C10H9NO |
| Peso Molecolare |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-2-3-9-8(6-12)5-11-10(9)4-7/h2-6,11H,1H3 |
| Numero CAS |
4771-49-7 |
| Struttura molecolare |
|
| Densità |
1.226g/cm3 |
| Punto di ebollizione |
339.3°C at 760 mmHg |
| Indice di rifrazione |
1.698 |
| Punto d'infiammabilità |
167°C |
| Pressione di vapore |
9.27E-05mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|