ChemNet > CAS > 4771-49-7 6-Methylindole-3-caboxaldehyde
4771-49-7 6-Methylindole-3-caboxaldehyde
| Nama produk |
6-Methylindole-3-caboxaldehyde |
| Nama bahasa Inggris |
6-Methylindole-3-caboxaldehyde; 6-Methylindole-3-carboxaldehyde; 3-Formyl-6-methylindole; 6-methyl-1H-indole-3-carbaldehyde |
| MF |
C10H9NO |
| Berat Molekul |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-2-3-9-8(6-12)5-11-10(9)4-7/h2-6,11H,1H3 |
| CAS NO |
4771-49-7 |
| Struktur Molekul |
|
| Kepadatan |
1.226g/cm3 |
| Titik didih |
339.3°C at 760 mmHg |
| Indeks bias |
1.698 |
| Titik nyala |
167°C |
| Tekanan uap |
9.27E-05mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|