1706-11-2 2,5-Dimethylanisole
| Nome do produto |
2,5-Dimethylanisole |
| Nome em inglês |
2,5-Dimethylanisole; 1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
| Fórmula molecular |
C9H12O |
| Peso Molecular |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
| CAS Registry Number |
1706-11-2 |
| EINECS |
216-943-8 |
| Estrutura Molecular |
|
| Densidade |
0.932g/cm3 |
| Ponto de ebuli??o |
189.7°C at 760 mmHg |
| índice de refra??o |
1.495 |
| O ponto de inflama??o |
66.1°C |
| Press?o de vapor |
0.778mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|