1706-11-2 2,5-Dimethylanisole
| product Name |
2,5-Dimethylanisole |
| CAS No |
1706-11-2 |
| Synonyms |
1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
| Molecular Formula |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
| EINECS |
216-943-8 |
| Molecular Structure |
|
| Density |
0.932g/cm3 |
| Boiling point |
189.7°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
66.1°C |
| Vapour Pressur |
0.778mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|