1706-11-2 2,5-Dimethylanisole
| Nama produk |
2,5-Dimethylanisole |
| Nama bahasa Inggris |
2,5-Dimethylanisole; 1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
| MF |
C9H12O |
| Berat Molekul |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
| CAS NO |
1706-11-2 |
| EINECS |
216-943-8 |
| Struktur Molekul |
|
| Kepadatan |
0.932g/cm3 |
| Titik didih |
189.7°C at 760 mmHg |
| Indeks bias |
1.495 |
| Titik nyala |
66.1°C |
| Tekanan uap |
0.778mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|