1706-11-2 2,5-Dimethylanisole
| Nazwa produktu: |
2,5-Dimethylanisole |
| Angielska nazwa |
2,5-Dimethylanisole; 1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
| MF |
C9H12O |
| Masie cz?steczkowej |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
| Nr CAS |
1706-11-2 |
| EINECS |
216-943-8 |
| Struktury molekularnej |
|
| G?sto?? |
0.932g/cm3 |
| Temperatura wrzenia |
189.7°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.495 |
| Temperatura zap?onu |
66.1°C |
| Ci?nienie pary |
0.778mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|