933-75-5 2,3,6-Trichlorophenol
| Nazwa produktu: |
2,3,6-Trichlorophenol |
| Angielska nazwa |
2,3,6-Trichlorophenol; |
| MF |
C6H3Cl3O |
| Masie cz?steczkowej |
197.4464 |
| InChI |
InChI=1/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
| Nr CAS |
933-75-5 |
| EINECS |
213-271-7 |
| Struktury molekularnej |
|
| G?sto?? |
1.596g/cm3 |
| Temperatura topnienia |
53-57℃ |
| Temperatura wrzenia |
230.6°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.608 |
| Temperatura zap?onu |
93.3°C |
| Ci?nienie pary |
0.043mmHg at 25°C |
| Symbole zagro?enia |
Xn:Harmful;
|
| Kody ryzyka |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|