933-75-5 2,3,6-Trichlorophenol
| product Name |
2,3,6-Trichlorophenol |
| CAS No |
933-75-5 |
| Molecular Formula |
C6H3Cl3O |
| Molecular Weight |
197.4464 |
| InChI |
InChI=1/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
| EINECS |
213-271-7 |
| Molecular Structure |
|
| Density |
1.596g/cm3 |
| Melting point |
53-57℃ |
| Boiling point |
230.6°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
93.3°C |
| Vapour Pressur |
0.043mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|