933-75-5 2,3,6-Trichlorophenol
| Nama produk |
2,3,6-Trichlorophenol |
| Nama bahasa Inggris |
2,3,6-Trichlorophenol; |
| MF |
C6H3Cl3O |
| Berat Molekul |
197.4464 |
| InChI |
InChI=1/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
| CAS NO |
933-75-5 |
| EINECS |
213-271-7 |
| Struktur Molekul |
|
| Kepadatan |
1.596g/cm3 |
| Titik lebur |
53-57℃ |
| Titik didih |
230.6°C at 760 mmHg |
| Indeks bias |
1.608 |
| Titik nyala |
93.3°C |
| Tekanan uap |
0.043mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|