933-75-5 2,3,6-Trichlorophenol
| Produkt-Name |
2,3,6-Trichlorophenol |
| Englischer Name |
2,3,6-Trichlorophenol; |
| Molekulare Formel |
C6H3Cl3O |
| Molecular Weight |
197.4464 |
| InChI |
InChI=1/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
| CAS Registry Number |
933-75-5 |
| EINECS |
213-271-7 |
| Molecular Structure |
|
| Dichte |
1.596g/cm3 |
| Schmelzpunkt |
53-57℃ |
| Siedepunkt |
230.6°C at 760 mmHg |
| Brechungsindex |
1.608 |
| Flammpunkt |
93.3°C |
| Dampfdruck |
0.043mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|