886-38-4 Diphenylcyclopropenone
| ürün Ad? |
Diphenylcyclopropenone |
| ingilizce ad? |
Diphenylcyclopropenone; Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
| Moleküler Formülü |
C15H10O |
| Molekül A??rl??? |
206.2393 |
| InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| CAS kay?t numaras? |
886-38-4 |
| EINECS |
212-948-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.232g/cm3 |
| Ergime noktas? |
119-121℃ |
| Kaynama noktas? |
407.2°C at 760 mmHg |
| K?r?lma indisi |
1.668 |
| Alevlenme noktas? |
182.7°C |
| Buhar bas?nc? |
7.66E-07mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R43:May cause sensitization by skin contact.;
|
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|