886-38-4 Diphenylcyclopropenone
| Naam product |
Diphenylcyclopropenone |
| Engelse naam |
Diphenylcyclopropenone; Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
| MF |
C15H10O |
| Molecuulgewicht |
206.2393 |
| InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| CAS-nummer |
886-38-4 |
| EINECS |
212-948-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.232g/cm3 |
| Smeltpunt |
119-121℃ |
| Kookpunt |
407.2°C at 760 mmHg |
| Brekingsindex |
1.668 |
| Vlampunt |
182.7°C |
| Dampdruk |
7.66E-07mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R43:May cause sensitization by skin contact.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|