886-38-4 Diphenylcyclopropenone
| produktnavn |
Diphenylcyclopropenone |
| Engelsk navn |
Diphenylcyclopropenone; Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
| Molekyl?r Formel |
C15H10O |
| Molekylvekt |
206.2393 |
| InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| CAS-nummer |
886-38-4 |
| EINECS |
212-948-4 |
| Molecular Structure |
|
| Tetthet |
1.232g/cm3 |
| Smeltepunkt |
119-121℃ |
| Kokepunkt |
407.2°C at 760 mmHg |
| Brytningsindeks |
1.668 |
| Flammepunktet |
182.7°C |
| Damptrykk |
7.66E-07mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R43:May cause sensitization by skin contact.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|