ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
| ürün Ad? |
Dimethyl phenylphosphonite |
| ingilizce ad? |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
| Moleküler Formülü |
C8H11O2P |
| Molekül A??rl??? |
170.1455 |
| InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| CAS kay?t numaras? |
2946-61-4 |
| EINECS |
220-960-6 |
| Moleküler Yap?s? |
|
| Kaynama noktas? |
194.1°C at 760 mmHg |
| Alevlenme noktas? |
81°C |
| Buhar bas?nc? |
0.628mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|