ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
| termék neve |
Dimethyl phenylphosphonite |
| Angol név |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
| MF |
C8H11O2P |
| Molekulat?meg |
170.1455 |
| InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| CAS-szám |
2946-61-4 |
| EINECS |
220-960-6 |
| Molekuláris szerkezete |
|
| Forráspont |
194.1°C at 760 mmHg |
| Gyulladáspont |
81°C |
| G?znyomás |
0.628mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|