ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
| Naam product |
Dimethyl phenylphosphonite |
| Engelse naam |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
| MF |
C8H11O2P |
| Molecuulgewicht |
170.1455 |
| InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| CAS-nummer |
2946-61-4 |
| EINECS |
220-960-6 |
| Moleculaire Structuur |
|
| Kookpunt |
194.1°C at 760 mmHg |
| Vlampunt |
81°C |
| Dampdruk |
0.628mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|