2777-65-3 10-Undecynoic acid
| ürün Ad? |
10-Undecynoic acid |
| ingilizce ad? |
10-Undecynoic acid; |
| Moleküler Formülü |
C11H18O2 |
| Molekül A??rl??? |
182.2594 |
| InChI |
InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| CAS kay?t numaras? |
2777-65-3 |
| EINECS |
220-471-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.966g/cm3 |
| Kaynama noktas? |
297.7°C at 760 mmHg |
| K?r?lma indisi |
1.468 |
| Alevlenme noktas? |
142.9°C |
| Buhar bas?nc? |
0.000317mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|