2777-65-3 10-Undecynoic acid
| ?? ????? |
10-Undecynoic acid |
| ?? ????? |
10-Undecynoic acid; |
| ????????? ??????? |
C11H18O2 |
| ???? ???????? |
182.2594 |
| InChI |
InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| ???? CAS |
2777-65-3 |
| EINECS |
220-471-8 |
| ???? ???????? |
|
| ?????? |
0.966g/cm3 |
| ????? ????? |
297.7°C at 760 mmHg |
| ???? ????? |
1.468 |
| ????? ???? |
142.9°C |
| ??? ???? |
0.000317mmHg at 25°C |
| ??????? ???? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|