2777-65-3 10-Undecynoic acid
| Nome do produto |
10-Undecynoic acid |
| Nome em inglês |
10-Undecynoic acid; |
| Fórmula molecular |
C11H18O2 |
| Peso Molecular |
182.2594 |
| InChI |
InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| CAS Registry Number |
2777-65-3 |
| EINECS |
220-471-8 |
| Estrutura Molecular |
|
| Densidade |
0.966g/cm3 |
| Ponto de ebuli??o |
297.7°C at 760 mmHg |
| índice de refra??o |
1.468 |
| O ponto de inflama??o |
142.9°C |
| Press?o de vapor |
0.000317mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|