ChemNet > CAS > 23132-21-0 2-Bromo-3-methyl-5-nitropyridine
23132-21-0 2-Bromo-3-methyl-5-nitropyridine
| ürün Ad? |
2-Bromo-3-methyl-5-nitropyridine |
| ingilizce ad? |
2-Bromo-3-methyl-5-nitropyridine; 2-Bromo-5-nitro-3-picoline |
| Moleküler Formülü |
C6H5BrN2O2 |
| Molekül A??rl??? |
217.0201 |
| InChI |
InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| CAS kay?t numaras? |
23132-21-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.709g/cm3 |
| Kaynama noktas? |
305.1°C at 760 mmHg |
| K?r?lma indisi |
1.599 |
| Alevlenme noktas? |
138.3°C |
| Buhar bas?nc? |
0.00151mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|