ChemNet > CAS > 23132-21-0 2-Bromo-3-methyl-5-nitropyridine
23132-21-0 2-Bromo-3-methyl-5-nitropyridine
| ?? ????? |
2-Bromo-3-methyl-5-nitropyridine |
| ?? ????? |
2-Bromo-3-methyl-5-nitropyridine; 2-Bromo-5-nitro-3-picoline |
| ????????? ??????? |
C6H5BrN2O2 |
| ???? ???????? |
217.0201 |
| InChI |
InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| ???? CAS |
23132-21-0 |
| ???? ???????? |
|
| ?????? |
1.709g/cm3 |
| ????? ????? |
305.1°C at 760 mmHg |
| ???? ????? |
1.599 |
| ????? ???? |
138.3°C |
| ??? ???? |
0.00151mmHg at 25°C |
| ??????? ???? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|