ChemNet > CAS > 23132-21-0 2-Bromo-3-methyl-5-nitropyridine
23132-21-0 2-Bromo-3-methyl-5-nitropyridine
| Produkt-Name |
2-Bromo-3-methyl-5-nitropyridine |
| Englischer Name |
2-Bromo-3-methyl-5-nitropyridine; 2-Bromo-5-nitro-3-picoline |
| Molekulare Formel |
C6H5BrN2O2 |
| Molecular Weight |
217.0201 |
| InChI |
InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| CAS Registry Number |
23132-21-0 |
| Molecular Structure |
|
| Dichte |
1.709g/cm3 |
| Siedepunkt |
305.1°C at 760 mmHg |
| Brechungsindex |
1.599 |
| Flammpunkt |
138.3°C |
| Dampfdruck |
0.00151mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|