20780-76-1 5-Iodoisatin
| ürün Ad? |
5-Iodoisatin |
| ingilizce ad? |
5-Iodoisatin; 5-Iodo-1H-indole-2,3-dione; NSC 92515; Iodoisatin, 5- |
| Moleküler Formülü |
C8H4INO2 |
| Molekül A??rl??? |
273.0273 |
| InChI |
InChI=1/C8H4INO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| CAS kay?t numaras? |
20780-76-1 |
| EINECS |
244-035-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
2.106g/cm3 |
| Ergime noktas? |
276-278℃ |
| K?r?lma indisi |
1.704 |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|