20780-76-1 5-Iodoisatin
| Produkt-Name |
5-Iodoisatin |
| Englischer Name |
5-Iodoisatin; 5-Iodo-1H-indole-2,3-dione; NSC 92515; Iodoisatin, 5- |
| Molekulare Formel |
C8H4INO2 |
| Molecular Weight |
273.0273 |
| InChI |
InChI=1/C8H4INO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| CAS Registry Number |
20780-76-1 |
| EINECS |
244-035-1 |
| Molecular Structure |
|
| Dichte |
2.106g/cm3 |
| Schmelzpunkt |
276-278℃ |
| Brechungsindex |
1.704 |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|