20780-76-1 5-Iodoisatin
| Nama produk |
5-Iodoisatin |
| Nama bahasa Inggris |
5-Iodoisatin; 5-Iodo-1H-indole-2,3-dione; NSC 92515; Iodoisatin, 5- |
| MF |
C8H4INO2 |
| Berat Molekul |
273.0273 |
| InChI |
InChI=1/C8H4INO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| CAS NO |
20780-76-1 |
| EINECS |
244-035-1 |
| Struktur Molekul |
|
| Kepadatan |
2.106g/cm3 |
| Titik lebur |
276-278℃ |
| Indeks bias |
1.704 |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|