ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
| ürün Ad? |
Mercaptopropionicacidethylester |
| ingilizce ad? |
Mercaptopropionicacidethylester; 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
| Moleküler Formülü |
C5H10O2S |
| Molekül A??rl??? |
134.1967 |
| InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
| CAS kay?t numaras? |
19788-49-9 |
| EINECS |
243-314-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.04g/cm3 |
| Kaynama noktas? |
171.7°C at 760 mmHg |
| K?r?lma indisi |
1.452 |
| Alevlenme noktas? |
57.4°C |
| Buhar bas?nc? |
1.38mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|