ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
| Nome do produto |
Mercaptopropionicacidethylester |
| Nome em inglês |
Mercaptopropionicacidethylester; 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
| Fórmula molecular |
C5H10O2S |
| Peso Molecular |
134.1967 |
| InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
| CAS Registry Number |
19788-49-9 |
| EINECS |
243-314-5 |
| Estrutura Molecular |
|
| Densidade |
1.04g/cm3 |
| Ponto de ebuli??o |
171.7°C at 760 mmHg |
| índice de refra??o |
1.452 |
| O ponto de inflama??o |
57.4°C |
| Press?o de vapor |
1.38mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|