ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
| ??? ????? |
Mercaptopropionicacidethylester |
| ??? ??????? |
Mercaptopropionicacidethylester; 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
| ????? ???????? |
C5H10O2S |
| ??? ??????? |
134.1967 |
| InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
| ????? ?????? |
19788-49-9 |
| ????? ??????? ??????? |
243-314-5 |
| ?????? ??????? |
|
| ????? |
1.04g/cm3 |
| ???? ????? |
171.7°C at 760 mmHg |
| ???? ???? |
1.452 |
| ???? ?????? |
57.4°C |
| ???? ???? |
1.38mmHg at 25°C |
| ????? ??? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| ??????? ????? |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|