120-50-3 Isobutyl benzoate
| ürün Ad? |
Isobutyl benzoate |
| ingilizce ad? |
Isobutyl benzoate; Isobutyl benzoate, (Benzoic acid isobutyl ester); Benzoic acid isobutyl ester |
| Moleküler Formülü |
C11H14O2 |
| Molekül A??rl??? |
178.23
|
| InChI |
InChI=1/C11H14O2/c1-9(2)8-13-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| CAS kay?t numaras? |
120-50-3 |
| EINECS |
204-401-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.999 |
| Kaynama noktas? |
240-242℃ |
| K?r?lma indisi |
1.493-1.495 |
| Alevlenme noktas? |
96℃ |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|