120-50-3 Isobutyl benzoate
| Nome del prodotto |
Isobutyl benzoate |
| Nome inglese |
Isobutyl benzoate; Isobutyl benzoate, (Benzoic acid isobutyl ester); Benzoic acid isobutyl ester |
| Formula molecolare |
C11H14O2 |
| Peso Molecolare |
178.23
|
| InChI |
InChI=1/C11H14O2/c1-9(2)8-13-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| Numero CAS |
120-50-3 |
| EINECS |
204-401-3 |
| Struttura molecolare |
|
| Densità |
0.999 |
| Punto di ebollizione |
240-242℃ |
| Indice di rifrazione |
1.493-1.495 |
| Punto d'infiammabilità |
96℃ |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|