120-50-3 Isobutyl benzoate
| Nama produk |
Isobutyl benzoate |
| Nama bahasa Inggris |
Isobutyl benzoate; Isobutyl benzoate, (Benzoic acid isobutyl ester); Benzoic acid isobutyl ester |
| MF |
C11H14O2 |
| Berat Molekul |
178.23
|
| InChI |
InChI=1/C11H14O2/c1-9(2)8-13-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| CAS NO |
120-50-3 |
| EINECS |
204-401-3 |
| Struktur Molekul |
|
| Kepadatan |
0.999 |
| Titik didih |
240-242℃ |
| Indeks bias |
1.493-1.495 |
| Titik nyala |
96℃ |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|