ChemNet > CAS > 10342-85-5 4-Piperidinoacetophenone
10342-85-5 4-Piperidinoacetophenone
| ürün Ad? |
4-Piperidinoacetophenone |
| ingilizce ad? |
4-Piperidinoacetophenone; N-(4-Acetylphenyl)piperidine; 1-[4-(piperidin-1-yl)phenyl]ethanone; 4'-PIPERIDINOACETOPHENONE |
| Moleküler Formülü |
C13H17NO |
| Molekül A??rl??? |
203.2802 |
| InChI |
InChI=1/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| CAS kay?t numaras? |
10342-85-5 |
| EINECS |
233-746-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.052g/cm3 |
| Ergime noktas? |
84-90℃ |
| Kaynama noktas? |
357.8°C at 760 mmHg |
| K?r?lma indisi |
1.545 |
| Alevlenme noktas? |
140.2°C |
| Buhar bas?nc? |
2.66E-05mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|