ChemNet > CAS > 10342-85-5 4-Piperidinoacetophenone
10342-85-5 4-Piperidinoacetophenone
| product Name |
4-Piperidinoacetophenone |
| CAS No |
10342-85-5 |
| Synonyms |
N-(4-Acetylphenyl)piperidine; 1-[4-(piperidin-1-yl)phenyl]ethanone; 4'-PIPERIDINOACETOPHENONE |
| Molecular Formula |
C13H17NO |
| Molecular Weight |
203.2802 |
| InChI |
InChI=1/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| EINECS |
233-746-2 |
| Molecular Structure |
|
| Density |
1.052g/cm3 |
| Melting point |
84-90℃ |
| Boiling point |
357.8°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
140.2°C |
| Vapour Pressur |
2.66E-05mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|