ChemNet > CAS > 10342-85-5 4-Piperidinoacetophenone
10342-85-5 4-Piperidinoacetophenone
| Nama produk |
4-Piperidinoacetophenone |
| Nama Inggeris |
4-Piperidinoacetophenone; N-(4-Acetylphenyl)piperidine; 1-[4-(piperidin-1-yl)phenyl]ethanone; 4'-PIPERIDINOACETOPHENONE |
| MF |
C13H17NO |
| Berat Molekul |
203.2802 |
| InChI |
InChI=1/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| CAS NO |
10342-85-5 |
| EINECS |
233-746-2 |
| Struktur Molekul |
|
| Kepadatan |
1.052g/cm3 |
| Titik lebur |
84-90℃ |
| Titik didih |
357.8°C at 760 mmHg |
| Indeks bias |
1.545 |
| Titik nyala |
140.2°C |
| Tekanan wap |
2.66E-05mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|