ChemNet > CAS > 1643-28-3 3-(2-Chlorophenyl)propionic acid
1643-28-3 3-(2-Chlorophenyl)propionic acid
| ??? ?????? |
3-(2-Chlorophenyl)propionic acid |
| ????? ??????????? |
3-(2-Chlorophenyl)propionic acid; Benzenepropanoic acid, 2-chloro-; 2-Chlorobenzenepropanoic acid; 3-(2-chlorophenyl)propanoic acid; 3-(2-chlorophenyl)propanoate |
| ?????? ???????? |
C9H8ClO2 |
| ????? ??????? ??????? |
183.6122 |
| InChI |
InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| ?????????? ???????? ??????? |
1643-28-3 |
| ???? ?????? |
|
| ???? ??????? |
306.6°C at 760 mmHg |
| ???? ?????? |
139.2°C |
| ??? ?????? |
0.000333mmHg at 25°C |
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|