ChemNet > CAS > 1643-28-3 3-(2-Chlorophenyl)propionic acid
1643-28-3 3-(2-Chlorophenyl)propionic acid
| Nome del prodotto |
3-(2-Chlorophenyl)propionic acid |
| Nome inglese |
3-(2-Chlorophenyl)propionic acid; Benzenepropanoic acid, 2-chloro-; 2-Chlorobenzenepropanoic acid; 3-(2-chlorophenyl)propanoic acid; 3-(2-chlorophenyl)propanoate |
| Formula molecolare |
C9H8ClO2 |
| Peso Molecolare |
183.6122 |
| InChI |
InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| Numero CAS |
1643-28-3 |
| Struttura molecolare |
|
| Punto di ebollizione |
306.6°C at 760 mmHg |
| Punto d'infiammabilità |
139.2°C |
| Pressione di vapore |
0.000333mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|