ChemNet > CAS > 1643-28-3 3-(2-Chlorophenyl)propionic acid
1643-28-3 3-(2-Chlorophenyl)propionic acid
| Nama produk |
3-(2-Chlorophenyl)propionic acid |
| Nama Inggeris |
3-(2-Chlorophenyl)propionic acid; Benzenepropanoic acid, 2-chloro-; 2-Chlorobenzenepropanoic acid; 3-(2-chlorophenyl)propanoic acid; 3-(2-chlorophenyl)propanoate |
| MF |
C9H8ClO2 |
| Berat Molekul |
183.6122 |
| InChI |
InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| CAS NO |
1643-28-3 |
| Struktur Molekul |
|
| Titik didih |
306.6°C at 760 mmHg |
| Titik nyala |
139.2°C |
| Tekanan wap |
0.000333mmHg at 25°C |
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|