ChemNet > CAS > 6258-60-2 4-Methoxybenzyl mercaptan
6258-60-2 4-Methoxybenzyl mercaptan
| Nome do produto |
4-Methoxybenzyl mercaptan |
| Nome em inglês |
4-Methoxybenzyl mercaptan; 4-Methoxy-alpha-toluenethiol = 4-Methoxybenzyl Mercaptan; 4-Methoxy-alpha-toluenethiol; (4-methoxyphenyl)methanethiol; 4-Metoxy benzyl mercaptan |
| Fórmula molecular |
C8H10OS |
| Peso Molecular |
154.2294 |
| InChI |
InChI=1/C8H10OS/c1-9-8-4-2-7(6-10)3-5-8/h2-5,10H,6H2,1H3 |
| CAS Registry Number |
6258-60-2 |
| EINECS |
228-393-6 |
| Estrutura Molecular |
|
| Densidade |
1.072g/cm3 |
| Ponto de ebuli??o |
294.5°C at 760 mmHg |
| índice de refra??o |
1.549 |
| O ponto de inflama??o |
103.4°C |
| Press?o de vapor |
0.00284mmHg at 25°C |
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|