ChemNet > CAS > 6258-60-2 4-Methoxybenzyl mercaptan
6258-60-2 4-Methoxybenzyl mercaptan
| název vyrobku |
4-Methoxybenzyl mercaptan |
| Anglicky název |
4-Methoxybenzyl mercaptan; 4-Methoxy-alpha-toluenethiol = 4-Methoxybenzyl Mercaptan; 4-Methoxy-alpha-toluenethiol; (4-methoxyphenyl)methanethiol; 4-Metoxy benzyl mercaptan |
| Molekulární vzorec |
C8H10OS |
| Molekulová hmotnost |
154.2294 |
| InChI |
InChI=1/C8H10OS/c1-9-8-4-2-7(6-10)3-5-8/h2-5,10H,6H2,1H3 |
| Registra?ní ?íslo CAS |
6258-60-2 |
| EINECS |
228-393-6 |
| Molekulární struktura |
|
| Hustota |
1.072g/cm3 |
| Bod varu |
294.5°C at 760 mmHg |
| Index lomu |
1.549 |
| Bod vzplanutí |
103.4°C |
| Tlak par |
0.00284mmHg at 25°C |
| Bezpe?nostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|