ChemNet > CAS > 6258-60-2 4-Methoxybenzyl mercaptan
6258-60-2 4-Methoxybenzyl mercaptan
| product Name |
4-Methoxybenzyl mercaptan |
| CAS No |
6258-60-2 |
| Synonyms |
4-Methoxy-alpha-toluenethiol = 4-Methoxybenzyl Mercaptan; 4-Methoxy-alpha-toluenethiol; (4-methoxyphenyl)methanethiol; 4-Metoxy benzyl mercaptan |
| Molecular Formula |
C8H10OS |
| Molecular Weight |
154.2294 |
| InChI |
InChI=1/C8H10OS/c1-9-8-4-2-7(6-10)3-5-8/h2-5,10H,6H2,1H3 |
| EINECS |
228-393-6 |
| Molecular Structure |
|
| Density |
1.072g/cm3 |
| Boiling point |
294.5°C at 760 mmHg |
| Refractive index |
1.549 |
| Flash point |
103.4°C |
| Vapour Pressur |
0.00284mmHg at 25°C |
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-571-88902507;88902517;88902509 |
| Email |
shoufu@shoufuchem.com |
| Address |
5/F, Yangfan Venture Plaza, 31 Xincheng Road, Binjiang District, Hangzhou City, Zhejiang Province, P.R.China |